C15H12N2O7S — CID 47086958
phenyl 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)ethanesulfonate (PubChem CID 47086958) has the molecular formula C15H12N2O7S and a molecular weight of 364.34 g/mol. Its IUPAC name is phenyl 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)ethanesulfonate.
| Compound Name | phenyl 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)ethanesulfonate |
|---|---|
| PubChem CID | 47086958 |
| Molecular Formula | C15H12N2O7S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | phenyl 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)ethanesulfonate |
| SMILES | O=c1oc2cc([N+](=O)[O-])ccc2n1CCS(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H12N2O7S/c18-15-16(13-7-6-11(17(19)20)10-14(13)23-15)8-9-25(21,22)24-12-4-2-1-3-5-12/h1-7,10H,8-9H2 |
| InChIKey | OVZVMEMXDKAZTD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|