C26H18N2O4 — CID 135382299
6-nitro-3-trityl-1,3-benzoxazol-2-one (PubChem CID 135382299) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 6-nitro-3-trityl-1,3-benzoxazol-2-one.
| Compound Name | 6-nitro-3-trityl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 135382299 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 6-nitro-3-trityl-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2cc([N+](=O)[O-])ccc2n1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H18N2O4/c29-25-27(23-17-16-22(28(30)31)18-24(23)32-25)26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChIKey | NMUQZYNIBOVYQD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|