C45H34N4O2 — CID 142710416
5-nitro-N,1-ditritylindazol-3-amine (PubChem CID 142710416) has the molecular formula C45H34N4O2 and a molecular weight of 662.79 g/mol. Its IUPAC name is 5-nitro-N,1-ditritylindazol-3-amine.
| Compound Name | 5-nitro-N,1-ditritylindazol-3-amine |
|---|---|
| PubChem CID | 142710416 |
| Molecular Formula | C45H34N4O2 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 5-nitro-N,1-ditritylindazol-3-amine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c(NC(c1ccccc1)(c1ccccc1)c1ccccc1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H34N4O2/c50-49(51)40-31-32-42-41(33-40)43(46-44(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36)47-48(42)45(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39/h1-33H,(H,46,47) |
| InChIKey | FEUXANCZPSXBGP-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|