About 5-nitro-N,1-ditritylindazol-3-amine
5-nitro-N,1-ditritylindazol-3-amine (PubChem CID 142710416) has the molecular formula C45H34N4O2
and a molecular weight of 662.79 g/mol. Its IUPAC name is 5-nitro-N,1-ditritylindazol-3-amine.
Molecular Properties
| Compound Name | 5-nitro-N,1-ditritylindazol-3-amine |
| PubChem CID | 142710416 |
| Molecular Formula | C45H34N4O2 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 5-nitro-N,1-ditritylindazol-3-amine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c(NC(c1ccccc1)(c1ccccc1)c1ccccc1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H34N4O2/c50-49(51)40-31-32-42-41(33-40)43(46-44(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36)47-48(42)45(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39/h1-33H,(H,46,47) |
| InChIKey | FEUXANCZPSXBGP-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-N,1-ditritylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-N,1-ditritylindazol-3-amine?
The IUPAC name of 5-nitro-N,1-ditritylindazol-3-amine (CID 142710416) is 5-nitro-N,1-ditritylindazol-3-amine.
What is the SMILES notation for 5-nitro-N,1-ditritylindazol-3-amine?
The canonical SMILES for 5-nitro-N,1-ditritylindazol-3-amine is O=[N+]([O-])c1ccc2c(c1)c(NC(c1ccccc1)(c1ccccc1)c1ccccc1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-nitro-N,1-ditritylindazol-3-amine?
The InChIKey is FEUXANCZPSXBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H34N4O2/c50-49(51)40-31-32-42-41(33-40)43(46-44(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36)47-48(42)45(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39/h1-33H,(H,46,47).
What are the key properties of 5-nitro-N,1-ditritylindazol-3-amine?
5-nitro-N,1-ditritylindazol-3-amine has a molecular weight of 662.79 g/mol, XLogP of 10.19, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-N,1-ditritylindazol-3-amine is sourced from PubChem (CID 142710416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).