C33H34BN3O2 — CID 174124984
N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-amine (PubChem CID 174124984) has the molecular formula C33H34BN3O2 and a molecular weight of 515.47 g/mol. Its IUPAC name is N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-amine.
| Compound Name | N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-amine |
|---|---|
| PubChem CID | 174124984 |
| Molecular Formula | C33H34BN3O2 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylindazol-3-amine |
| SMILES | CNc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C33H34BN3O2/c1-31(2)32(3,4)39-34(38-31)27-21-22-29-28(23-27)30(35-5)36-37(29)33(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-23H,1-5H3,(H,35,36) |
| InChIKey | DFPIWVBWIZUIMM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|