C32H32BN3O2 — CID 169106746
4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylbenzotriazole (PubChem CID 169106746) has the molecular formula C32H32BN3O2 and a molecular weight of 501.44 g/mol. Its IUPAC name is 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylbenzotriazole.
| Compound Name | 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylbenzotriazole |
|---|---|
| PubChem CID | 169106746 |
| Molecular Formula | C32H32BN3O2 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylbenzotriazole |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1nnn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32BN3O2/c1-23-21-27(33-37-30(2,3)31(4,5)38-33)22-28-29(23)34-35-36(28)32(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-22H,1-5H3 |
| InChIKey | LXRXUEPOSFWLOO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|