C22H27BN2O4S — CID 162735970
1,4-dimethyl-2-(4-methylsulfonylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole (PubChem CID 162735970) has the molecular formula C22H27BN2O4S and a molecular weight of 426.35 g/mol. Its IUPAC name is 1,4-dimethyl-2-(4-methylsulfonylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole.
| Compound Name | 1,4-dimethyl-2-(4-methylsulfonylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 162735970 |
| Molecular Formula | C22H27BN2O4S |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1,4-dimethyl-2-(4-methylsulfonylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1nc(-c1ccc(S(C)(=O)=O)cc1)n2C |
| InChI | InChI=1S/C22H27BN2O4S/c1-14-12-16(23-28-21(2,3)22(4,5)29-23)13-18-19(14)24-20(25(18)6)15-8-10-17(11-9-15)30(7,26)27/h8-13H,1-7H3 |
| InChIKey | QUFYFQYGOQWXRA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|