C31H30BN3O2 — CID 153405939
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tritylpyrrolo[2,3-b]pyrazine (PubChem CID 153405939) has the molecular formula C31H30BN3O2 and a molecular weight of 487.41 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tritylpyrrolo[2,3-b]pyrazine.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tritylpyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 153405939 |
| Molecular Formula | C31H30BN3O2 |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tritylpyrrolo[2,3-b]pyrazine |
| SMILES | CC1(C)OB(c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3nccnc23)OC1(C)C |
| InChI | InChI=1S/C31H30BN3O2/c1-29(2)30(3,4)37-32(36-29)26-22-35(28-27(26)33-20-21-34-28)31(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-22H,1-4H3 |
| InChIKey | XSFSFKHUJXJLRU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|