C25H20N4O — CID 155749912
3-methyl-4-oxido-1-tritylpyrazolo[3,4-b]pyrazin-4-ium (PubChem CID 155749912) has the molecular formula C25H20N4O and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-methyl-4-oxido-1-tritylpyrazolo[3,4-b]pyrazin-4-ium.
| Compound Name | 3-methyl-4-oxido-1-tritylpyrazolo[3,4-b]pyrazin-4-ium |
|---|---|
| PubChem CID | 155749912 |
| Molecular Formula | C25H20N4O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-methyl-4-oxido-1-tritylpyrazolo[3,4-b]pyrazin-4-ium |
| SMILES | Cc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc[n+]([O-])c12 |
| InChI | InChI=1S/C25H20N4O/c1-19-23-24(26-17-18-28(23)30)29(27-19)25(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18H,1H3 |
| InChIKey | PBVZBRPIXCNEOK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|