C24H21IN2 — CID 102228984
4-iodo-3,5-dimethyl-1-tritylpyrazole (PubChem CID 102228984) has the molecular formula C24H21IN2 and a molecular weight of 464.35 g/mol. Its IUPAC name is 4-iodo-3,5-dimethyl-1-tritylpyrazole.
| Compound Name | 4-iodo-3,5-dimethyl-1-tritylpyrazole |
|---|---|
| PubChem CID | 102228984 |
| Molecular Formula | C24H21IN2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-iodo-3,5-dimethyl-1-tritylpyrazole |
| SMILES | Cc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1I |
| InChI | InChI=1S/C24H21IN2/c1-18-23(25)19(2)27(26-18)24(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17H,1-2H3 |
| InChIKey | KFEBPEDGIZRPIH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|