C22H16IN3O2 — CID 151203914
5-iodo-2-trityl-1,2,4-triazole-3-carboxylic acid (PubChem CID 151203914) has the molecular formula C22H16IN3O2 and a molecular weight of 481.29 g/mol. Its IUPAC name is 5-iodo-2-trityl-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 5-iodo-2-trityl-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 151203914 |
| Molecular Formula | C22H16IN3O2 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 5-iodo-2-trityl-1,2,4-triazole-3-carboxylic acid |
| SMILES | O=C(O)c1nc(I)nn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16IN3O2/c23-21-24-19(20(27)28)26(25-21)22(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H,27,28) |
| InChIKey | NIWNJFWBEARDMD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|