C28H19Cl2N3O3 — CID 160536392
5-(3,4-dichlorophenoxy)-3-trityltriazole-4-carboxylic acid (PubChem CID 160536392) has the molecular formula C28H19Cl2N3O3 and a molecular weight of 516.38 g/mol. Its IUPAC name is 5-(3,4-dichlorophenoxy)-3-trityltriazole-4-carboxylic acid.
| Compound Name | 5-(3,4-dichlorophenoxy)-3-trityltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 160536392 |
| Molecular Formula | C28H19Cl2N3O3 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 5-(3,4-dichlorophenoxy)-3-trityltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(Oc2ccc(Cl)c(Cl)c2)nnn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H19Cl2N3O3/c29-23-17-16-22(18-24(23)30)36-26-25(27(34)35)33(32-31-26)28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H,(H,34,35) |
| InChIKey | LMTWRICWGTXXLK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|