C37H35N3O5 — CID 159602310
2-methylpropanoyloxymethyl 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylate (PubChem CID 159602310) has the molecular formula C37H35N3O5 and a molecular weight of 601.70 g/mol. Its IUPAC name is 2-methylpropanoyloxymethyl 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylate.
| Compound Name | 2-methylpropanoyloxymethyl 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylate |
|---|---|
| PubChem CID | 159602310 |
| Molecular Formula | C37H35N3O5 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 2-methylpropanoyloxymethyl 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylate |
| SMILES | CC(C)C(=O)OCOC(=O)c1c(Oc2ccc3c(c2)CCCC3)nnn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H35N3O5/c1-26(2)35(41)43-25-44-36(42)33-34(45-32-23-22-27-14-12-13-15-28(27)24-32)38-39-40(33)37(29-16-6-3-7-17-29,30-18-8-4-9-19-30)31-20-10-5-11-21-31/h3-11,16-24,26H,12-15,25H2,1-2H3 |
| InChIKey | RGWMHGBZVAWRDC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|