C32H27N3O3 — CID 159602308
5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylic acid (PubChem CID 159602308) has the molecular formula C32H27N3O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylic acid.
| Compound Name | 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 159602308 |
| Molecular Formula | C32H27N3O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-3-trityltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(Oc2ccc3c(c2)CCCC3)nnn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27N3O3/c36-31(37)29-30(38-28-21-20-23-12-10-11-13-24(23)22-28)33-34-35(29)32(25-14-4-1-5-15-25,26-16-6-2-7-17-26)27-18-8-3-9-19-27/h1-9,14-22H,10-13H2,(H,36,37) |
| InChIKey | BKGULHIHKFGFFS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|