C15H15N3O — CID 28825165
2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-3-carboximidamide (PubChem CID 28825165) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-3-carboximidamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 28825165 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccnc1Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H15N3O/c16-14(17)13-5-2-8-18-15(13)19-12-7-6-10-3-1-4-11(10)9-12/h2,5-9H,1,3-4H2,(H3,16,17) |
| InChIKey | JQBBTMURCGNTFP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|