C15H15NO2 — CID 61257544
[2-(2,3-dihydro-1H-inden-5-yloxy)-3-pyridinyl]methanol (PubChem CID 61257544) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yloxy)-3-pyridinyl]methanol.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yloxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 61257544 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yloxy)-3-pyridinyl]methanol |
| SMILES | OCc1cccnc1Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H15NO2/c17-10-13-5-2-8-16-15(13)18-14-7-6-11-3-1-4-12(11)9-14/h2,5-9,17H,1,3-4,10H2 |
| InChIKey | VPERHQBUCRQNKG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |