C17H18O2 — CID 62134379
[4-(2,3-dihydro-1H-inden-5-yloxy)-2-methylphenyl]methanol (PubChem CID 62134379) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-inden-5-yloxy)-2-methylphenyl]methanol.
| Compound Name | [4-(2,3-dihydro-1H-inden-5-yloxy)-2-methylphenyl]methanol |
|---|---|
| PubChem CID | 62134379 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | [4-(2,3-dihydro-1H-inden-5-yloxy)-2-methylphenyl]methanol |
| SMILES | Cc1cc(Oc2ccc3c(c2)CCC3)ccc1CO |
| InChI | InChI=1S/C17H18O2/c1-12-9-16(8-6-15(12)11-18)19-17-7-5-13-3-2-4-14(13)10-17/h5-10,18H,2-4,11H2,1H3 |
| InChIKey | ZHNYLCMCWCCFGT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |