C16H14BrClO — CID 107087384
5-[2-(bromomethyl)-5-chlorophenoxy]-2,3-dihydro-1H-indene (PubChem CID 107087384) has the molecular formula C16H14BrClO and a molecular weight of 337.64 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-5-chlorophenoxy]-2,3-dihydro-1H-indene.
| Compound Name | 5-[2-(bromomethyl)-5-chlorophenoxy]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 107087384 |
| Molecular Formula | C16H14BrClO |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 5-[2-(bromomethyl)-5-chlorophenoxy]-2,3-dihydro-1H-indene |
| SMILES | Clc1ccc(CBr)c(Oc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C16H14BrClO/c17-10-13-4-6-14(18)9-16(13)19-15-7-5-11-2-1-3-12(11)8-15/h4-9H,1-3,10H2 |
| InChIKey | AJSLPTFUYHBHSE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|