C17H17ClN2O — CID 63525016
5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarboximidamide (PubChem CID 63525016) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarboximidamide.
| Compound Name | 5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 63525016 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Cl)ccc1Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H17ClN2O/c18-13-6-8-16(15(10-13)17(19)20)21-14-7-5-11-3-1-2-4-12(11)9-14/h5-10H,1-4H2,(H3,19,20) |
| InChIKey | GXKDPUHRGOHWIQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|