C18H20N2O — CID 61398694
2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)benzenecarboximidamide (PubChem CID 61398694) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)benzenecarboximidamide.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61398694 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1COc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H20N2O/c19-18(20)17-8-4-3-7-15(17)12-21-16-10-9-13-5-1-2-6-14(13)11-16/h3-4,7-11H,1-2,5-6,12H2,(H3,19,20) |
| InChIKey | GSXZZLHWFNUOBH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|