C17H16ClNOS — CID 63519659
4-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarbothioamide (PubChem CID 63519659) has the molecular formula C17H16ClNOS and a molecular weight of 317.84 g/mol. Its IUPAC name is 4-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 63519659 |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-chloro-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H16ClNOS/c18-13-6-8-15(17(19)21)16(10-13)20-14-7-5-11-3-1-2-4-12(11)9-14/h5-10H,1-4H2,(H2,19,21) |
| InChIKey | XYXHEZIDFGBSTL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|