C18H18O3 — CID 63513502
4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzoic acid (PubChem CID 63513502) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzoic acid.
| Compound Name | 4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzoic acid |
|---|---|
| PubChem CID | 63513502 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(Oc2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C18H18O3/c1-12-6-9-16(18(19)20)17(10-12)21-15-8-7-13-4-2-3-5-14(13)11-15/h6-11H,2-5H2,1H3,(H,19,20) |
| InChIKey | FTOBOSDHNFUWLI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |