C16H16O4 — CID 107708690
2-[4-(2-hydroxyethyl)phenoxy]-4-methylbenzoic acid (PubChem CID 107708690) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)phenoxy]-4-methylbenzoic acid.
| Compound Name | 2-[4-(2-hydroxyethyl)phenoxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 107708690 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)phenoxy]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(Oc2ccc(CCO)cc2)c1 |
| InChI | InChI=1S/C16H16O4/c1-11-2-7-14(16(18)19)15(10-11)20-13-5-3-12(4-6-13)8-9-17/h2-7,10,17H,8-9H2,1H3,(H,18,19) |
| InChIKey | UHGCZWQCASEMED-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |