C9H7ClF3NOS — CID 63094186
4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarbothioamide (PubChem CID 63094186) has the molecular formula C9H7ClF3NOS and a molecular weight of 269.68 g/mol. Its IUPAC name is 4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 63094186 |
| Molecular Formula | C9H7ClF3NOS |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1OCC(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NOS/c10-5-1-2-6(8(14)16)7(3-5)15-4-9(11,12)13/h1-3H,4H2,(H2,14,16) |
| InChIKey | OXLUZWXYNVVXHD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|