C9H7BrF3NOS — CID 107278243
2-bromo-4-(2,2,2-trifluoroethoxy)benzenecarbothioamide (PubChem CID 107278243) has the molecular formula C9H7BrF3NOS and a molecular weight of 314.13 g/mol. Its IUPAC name is 2-bromo-4-(2,2,2-trifluoroethoxy)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(2,2,2-trifluoroethoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 107278243 |
| Molecular Formula | C9H7BrF3NOS |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 2-bromo-4-(2,2,2-trifluoroethoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H7BrF3NOS/c10-7-3-5(15-4-9(11,12)13)1-2-6(7)8(14)16/h1-3H,4H2,(H2,14,16) |
| InChIKey | ORLUAHFHQKEXFP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|