C15H14BrNOS — CID 107278286
2-bromo-4-(3,4-dimethylphenoxy)benzenecarbothioamide (PubChem CID 107278286) has the molecular formula C15H14BrNOS and a molecular weight of 336.25 g/mol. Its IUPAC name is 2-bromo-4-(3,4-dimethylphenoxy)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(3,4-dimethylphenoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 107278286 |
| Molecular Formula | C15H14BrNOS |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-bromo-4-(3,4-dimethylphenoxy)benzenecarbothioamide |
| SMILES | Cc1ccc(Oc2ccc(C(N)=S)c(Br)c2)cc1C |
| InChI | InChI=1S/C15H14BrNOS/c1-9-3-4-11(7-10(9)2)18-12-5-6-13(15(17)19)14(16)8-12/h3-8H,1-2H3,(H2,17,19) |
| InChIKey | ZBURIFRKVVTSSL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|