C15H13BrClNOS — CID 107278341
2-bromo-4-(4-chloro-3,5-dimethylphenoxy)benzenecarbothioamide (PubChem CID 107278341) has the molecular formula C15H13BrClNOS and a molecular weight of 370.70 g/mol. Its IUPAC name is 2-bromo-4-(4-chloro-3,5-dimethylphenoxy)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(4-chloro-3,5-dimethylphenoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 107278341 |
| Molecular Formula | C15H13BrClNOS |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 2-bromo-4-(4-chloro-3,5-dimethylphenoxy)benzenecarbothioamide |
| SMILES | Cc1cc(Oc2ccc(C(N)=S)c(Br)c2)cc(C)c1Cl |
| InChI | InChI=1S/C15H13BrClNOS/c1-8-5-11(6-9(2)14(8)17)19-10-3-4-12(15(18)20)13(16)7-10/h3-7H,1-2H3,(H2,18,20) |
| InChIKey | VSXKAPRQUQVGIX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|