C12H12BrF3O3 — CID 103206758
1-(2-bromo-4-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 103206758) has the molecular formula C12H12BrF3O3 and a molecular weight of 341.12 g/mol. Its IUPAC name is 1-(2-bromo-4-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-(2-bromo-4-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 103206758 |
| Molecular Formula | C12H12BrF3O3 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 1-(2-bromo-4-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | CCOc1ccc(C(=O)COCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H12BrF3O3/c1-2-19-8-3-4-9(10(13)5-8)11(17)6-18-7-12(14,15)16/h3-5H,2,6-7H2,1H3 |
| InChIKey | UUQKLFBYKDACAH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |