C10H8BrF3O2 — CID 81429202
1-(2-bromo-4-ethoxyphenyl)-2,2,2-trifluoroethanone (PubChem CID 81429202) has the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. Its IUPAC name is 1-(2-bromo-4-ethoxyphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2-bromo-4-ethoxyphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 81429202 |
| Molecular Formula | C10H8BrF3O2 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 1-(2-bromo-4-ethoxyphenyl)-2,2,2-trifluoroethanone |
| SMILES | CCOc1ccc(C(=O)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H8BrF3O2/c1-2-16-6-3-4-7(8(11)5-6)9(15)10(12,13)14/h3-5H,2H2,1H3 |
| InChIKey | CWGYDECPAVEMSZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |