C12H14Br2O3 — CID 166607863
2,2-dibromo-1-(2,4-diethoxyphenyl)ethanone (PubChem CID 166607863) has the molecular formula C12H14Br2O3 and a molecular weight of 366.05 g/mol. Its IUPAC name is 2,2-dibromo-1-(2,4-diethoxyphenyl)ethanone.
| Compound Name | 2,2-dibromo-1-(2,4-diethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 166607863 |
| Molecular Formula | C12H14Br2O3 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 2,2-dibromo-1-(2,4-diethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(C(=O)C(Br)Br)c(OCC)c1 |
| InChI | InChI=1S/C12H14Br2O3/c1-3-16-8-5-6-9(11(15)12(13)14)10(7-8)17-4-2/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | GVUWFLYALQYAEO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|