C12H13F3O3 — CID 83952962
1-(2,4-diethoxyphenyl)-2,2,2-trifluoroethanone (PubChem CID 83952962) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-(2,4-diethoxyphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2,4-diethoxyphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 83952962 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(2,4-diethoxyphenyl)-2,2,2-trifluoroethanone |
| SMILES | CCOc1ccc(C(=O)C(F)(F)F)c(OCC)c1 |
| InChI | InChI=1S/C12H13F3O3/c1-3-17-8-5-6-9(10(7-8)18-4-2)11(16)12(13,14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | AQEVQRSJNBGIMH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |