C14H17F3N2O4 — CID 140543066
[5-ethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 140543066) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is [5-ethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-ethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140543066 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [5-ethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | CCOc1ccc(C(=O)NCCNC)c(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O4/c1-3-22-9-4-5-10(12(20)19-7-6-18-2)11(8-9)23-13(21)14(15,16)17/h4-5,8,18H,3,6-7H2,1-2H3,(H,19,20) |
| InChIKey | ZNWIVRMETFQXMS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|