C11H14BrNO3 — CID 90850179
2-bromo-N,4-diethoxybenzamide (PubChem CID 90850179) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 2-bromo-N,4-diethoxybenzamide.
| Compound Name | 2-bromo-N,4-diethoxybenzamide |
|---|---|
| PubChem CID | 90850179 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-bromo-N,4-diethoxybenzamide |
| SMILES | CCONC(=O)c1ccc(OCC)cc1Br |
| InChI | InChI=1S/C11H14BrNO3/c1-3-15-8-5-6-9(10(12)7-8)11(14)13-16-4-2/h5-7H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | XQFSFTTZGWNZTQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|