C13H18BrNO2S — CID 107278452
2-bromo-4-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide (PubChem CID 107278452) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 2-bromo-4-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 2-bromo-4-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 107278452 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-bromo-4-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide |
| SMILES | CC(C)COCCOc1ccc(C(N)=S)c(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-9(2)8-16-5-6-17-10-3-4-11(13(15)18)12(14)7-10/h3-4,7,9H,5-6,8H2,1-2H3,(H2,15,18) |
| InChIKey | CGCUFRVDGRDRMI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|