C13H18FNO2S — CID 106447630
5-fluoro-2-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide (PubChem CID 106447630) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is 5-fluoro-2-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 5-fluoro-2-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 106447630 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5-fluoro-2-[2-(2-methylpropoxy)ethoxy]benzenecarbothioamide |
| SMILES | CC(C)COCCOc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C13H18FNO2S/c1-9(2)8-16-5-6-17-12-4-3-10(14)7-11(12)13(15)18/h3-4,7,9H,5-6,8H2,1-2H3,(H2,15,18) |
| InChIKey | YEXMNEPFQRHGNT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|