C12H16FNO3S — CID 104561810
5-fluoro-2-[2-(2-methoxyethoxy)ethoxy]benzenecarbothioamide (PubChem CID 104561810) has the molecular formula C12H16FNO3S and a molecular weight of 273.33 g/mol. Its IUPAC name is 5-fluoro-2-[2-(2-methoxyethoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 5-fluoro-2-[2-(2-methoxyethoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 104561810 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 5-fluoro-2-[2-(2-methoxyethoxy)ethoxy]benzenecarbothioamide |
| SMILES | COCCOCCOc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C12H16FNO3S/c1-15-4-5-16-6-7-17-11-3-2-9(13)8-10(11)12(14)18/h2-3,8H,4-7H2,1H3,(H2,14,18) |
| InChIKey | JEDGHYOSNDMUCE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|