C10H12FNOS — CID 63673082
5-fluoro-2-propoxybenzenecarbothioamide (PubChem CID 63673082) has the molecular formula C10H12FNOS and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-fluoro-2-propoxybenzenecarbothioamide.
| Compound Name | 5-fluoro-2-propoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 63673082 |
| Molecular Formula | C10H12FNOS |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 5-fluoro-2-propoxybenzenecarbothioamide |
| SMILES | CCCOc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C10H12FNOS/c1-2-5-13-9-4-3-7(11)6-8(9)10(12)14/h3-4,6H,2,5H2,1H3,(H2,12,14) |
| InChIKey | SLPZTPDGCQPVFJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|