C10H10ClF3N2O3 — CID 106705042
4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethoxymethoxy)benzenecarboximidamide (PubChem CID 106705042) has the molecular formula C10H10ClF3N2O3 and a molecular weight of 298.65 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethoxymethoxy)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethoxymethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 106705042 |
| Molecular Formula | C10H10ClF3N2O3 |
| Molecular Weight | 298.65 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethoxymethoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Cl)cc1OCOCC(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O3/c11-6-1-2-7(9(15)16-17)8(3-6)19-5-18-4-10(12,13)14/h1-3,17H,4-5H2,(H2,15,16) |
| InChIKey | LUKHXXZQKVUKGK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|