C12H14ClF3N2O3 — CID 102724450
2-chloro-N'-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide (PubChem CID 102724450) has the molecular formula C12H14ClF3N2O3 and a molecular weight of 326.70 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 102724450 |
| Molecular Formula | C12H14ClF3N2O3 |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCCCOCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O3/c13-10-6-8(2-3-9(10)11(17)18-19)21-5-1-4-20-7-12(14,15)16/h2-3,6,19H,1,4-5,7H2,(H2,17,18) |
| InChIKey | VMPQWUYHKCIMTK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|