C8H7ClF2N2O2 — CID 102724409
2-chloro-4-(difluoromethoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 102724409) has the molecular formula C8H7ClF2N2O2 and a molecular weight of 236.61 g/mol. Its IUPAC name is 2-chloro-4-(difluoromethoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-chloro-4-(difluoromethoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 102724409 |
| Molecular Formula | C8H7ClF2N2O2 |
| Molecular Weight | 236.61 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-chloro-4-(difluoromethoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OC(F)F)cc1Cl |
| InChI | InChI=1S/C8H7ClF2N2O2/c9-6-3-4(15-8(10)11)1-2-5(6)7(12)13-14/h1-3,8,14H,(H2,12,13) |
| InChIKey | BUFLINZQZIWBFI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|