C12H17ClN2O2 — CID 102724420
2-chloro-N'-hydroxy-4-pentan-3-yloxybenzenecarboximidamide (PubChem CID 102724420) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-pentan-3-yloxybenzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-pentan-3-yloxybenzenecarboximidamide |
|---|---|
| PubChem CID | 102724420 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-pentan-3-yloxybenzenecarboximidamide |
| SMILES | CCC(CC)Oc1ccc(/C(N)=N/O)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-3-8(4-2)17-9-5-6-10(11(13)7-9)12(14)15-16/h5-8,16H,3-4H2,1-2H3,(H2,14,15) |
| InChIKey | WKFMFKPBOLWJLF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|