C12H11ClN2O2S — CID 102724484
2-chloro-N'-hydroxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide (PubChem CID 102724484) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 102724484 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCc2ccsc2)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O2S/c13-11-5-9(1-2-10(11)12(14)15-16)17-6-8-3-4-18-7-8/h1-5,7,16H,6H2,(H2,14,15) |
| InChIKey | HLILLKMORMJXNA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|