C9H8ClF3N2O — CID 63093707
4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarboximidamide (PubChem CID 63093707) has the molecular formula C9H8ClF3N2O and a molecular weight of 252.62 g/mol. Its IUPAC name is 4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarboximidamide.
| Compound Name | 4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 63093707 |
| Molecular Formula | C9H8ClF3N2O |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-chloro-2-(2,2,2-trifluoroethoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)cc1OCC(F)(F)F |
| InChI | InChI=1S/C9H8ClF3N2O/c10-5-1-2-6(8(14)15)7(3-5)16-4-9(11,12)13/h1-3H,4H2,(H3,14,15) |
| InChIKey | QGVBOKGUHDTTJE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|