C23H23N3O2 — CID 56673227
N'-benzyl-N-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyridine-3-carboximidamide (PubChem CID 56673227) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N'-benzyl-N-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyridine-3-carboximidamide.
| Compound Name | N'-benzyl-N-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56673227 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N'-benzyl-N-hydroxy-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyridine-3-carboximidamide |
| SMILES | ON/C(=N\Cc1ccccc1)c1cccnc1Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H23N3O2/c27-26-22(25-16-17-7-2-1-3-8-17)21-11-6-14-24-23(21)28-20-13-12-18-9-4-5-10-19(18)15-20/h1-3,6-8,11-15,27H,4-5,9-10,16H2,(H,25,26) |
| InChIKey | IUDRRRPQGGWCML-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|