C14H12N2O3 — CID 141060321
2-(2,3-dihydro-1-benzofuran-5-yloxy)pyridine-3-carboxamide (PubChem CID 141060321) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yloxy)pyridine-3-carboxamide.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yloxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141060321 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yloxy)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1Oc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H12N2O3/c15-13(17)11-2-1-6-16-14(11)19-10-3-4-12-9(8-10)5-7-18-12/h1-4,6,8H,5,7H2,(H2,15,17) |
| InChIKey | ZFQKDQRDCJBQHO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |