C27H31N3O4S — CID 53120314
N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenoxy]pyridine-3-carboxamide (PubChem CID 53120314) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenoxy]pyridine-3-carboxamide.
| Compound Name | N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53120314 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenoxy]pyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cccnc1Oc1ccc(NS(=O)(=O)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C27H31N3O4S/c1-2-3-6-17-28-26(31)25-10-7-18-29-27(25)34-23-14-12-22(13-15-23)30-35(32,33)24-16-11-20-8-4-5-9-21(20)19-24/h7,10-16,18-19,30H,2-6,8-9,17H2,1H3,(H,28,31) |
| InChIKey | MAFHVKJVLTZYQR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|