C25H26N4O5S — CID 53120219
2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]-N-cyclopentylpyridine-3-carboxamide (PubChem CID 53120219) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]-N-cyclopentylpyridine-3-carboxamide.
| Compound Name | 2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]-N-cyclopentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53120219 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]-N-cyclopentylpyridine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Oc3ncccc3C(=O)NC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O5S/c1-17(30)27-19-10-14-22(15-11-19)35(32,33)29-20-8-12-21(13-9-20)34-25-23(7-4-16-26-25)24(31)28-18-5-2-3-6-18/h4,7-16,18,29H,2-3,5-6H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | PVGQUQWWIDWNCA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |