C23H22FN3O4S — CID 53117616
N-cyclopentyl-2-[3-[(4-fluorophenyl)sulfonylamino]phenoxy]pyridine-3-carboxamide (PubChem CID 53117616) has the molecular formula C23H22FN3O4S and a molecular weight of 455.51 g/mol. Its IUPAC name is N-cyclopentyl-2-[3-[(4-fluorophenyl)sulfonylamino]phenoxy]pyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-2-[3-[(4-fluorophenyl)sulfonylamino]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53117616 |
| Molecular Formula | C23H22FN3O4S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-cyclopentyl-2-[3-[(4-fluorophenyl)sulfonylamino]phenoxy]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cccnc1Oc1cccc(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H22FN3O4S/c24-16-10-12-20(13-11-16)32(29,30)27-18-7-3-8-19(15-18)31-23-21(9-4-14-25-23)22(28)26-17-5-1-2-6-17/h3-4,7-15,17,27H,1-2,5-6H2,(H,26,28) |
| InChIKey | HYMKYUXETGYHEK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |