C19H18ClN3O4S2 — CID 53120306
2-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-propylpyridine-3-carboxamide (PubChem CID 53120306) has the molecular formula C19H18ClN3O4S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is 2-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-propylpyridine-3-carboxamide.
| Compound Name | 2-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53120306 |
| Molecular Formula | C19H18ClN3O4S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 2-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-propylpyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1cccnc1Oc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C19H18ClN3O4S2/c1-2-11-21-18(24)15-4-3-12-22-19(15)27-14-7-5-13(6-8-14)23-29(25,26)17-10-9-16(20)28-17/h3-10,12,23H,2,11H2,1H3,(H,21,24) |
| InChIKey | RHBWSLHIDPCOCU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |