C18H16ClN3O4S2 — CID 46389231
4-[[5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyridinyl]oxy]-N-ethylbenzamide (PubChem CID 46389231) has the molecular formula C18H16ClN3O4S2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 4-[[5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyridinyl]oxy]-N-ethylbenzamide.
| Compound Name | 4-[[5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyridinyl]oxy]-N-ethylbenzamide |
|---|---|
| PubChem CID | 46389231 |
| Molecular Formula | C18H16ClN3O4S2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 4-[[5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyridinyl]oxy]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(Oc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cn2)cc1 |
| InChI | InChI=1S/C18H16ClN3O4S2/c1-2-20-18(23)12-3-6-14(7-4-12)26-16-9-5-13(11-21-16)22-28(24,25)17-10-8-15(19)27-17/h3-11,22H,2H2,1H3,(H,20,23) |
| InChIKey | GJYKJWTUOVYHER-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |