C19H16ClN3O4S2 — CID 53120065
6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-cyclopropylpyridine-3-carboxamide (PubChem CID 53120065) has the molecular formula C19H16ClN3O4S2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-cyclopropylpyridine-3-carboxamide.
| Compound Name | 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-cyclopropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53120065 |
| Molecular Formula | C19H16ClN3O4S2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-cyclopropylpyridine-3-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(Oc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2)nc1 |
| InChI | InChI=1S/C19H16ClN3O4S2/c20-16-8-10-18(28-16)29(25,26)23-14-4-6-15(7-5-14)27-17-9-1-12(11-21-17)19(24)22-13-2-3-13/h1,4-11,13,23H,2-3H2,(H,22,24) |
| InChIKey | QHHBDNAKCAYWEF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |